C20H21N3O4 — CID 143144401
ethane;methyl 3-[(4-methoxynaphthalene-1-carbonyl)amino]pyrazine-2-carboxylate (PubChem CID 143144401) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is ethane;methyl 3-[(4-methoxynaphthalene-1-carbonyl)amino]pyrazine-2-carboxylate.
| Compound Name | ethane;methyl 3-[(4-methoxynaphthalene-1-carbonyl)amino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 143144401 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | ethane;methyl 3-[(4-methoxynaphthalene-1-carbonyl)amino]pyrazine-2-carboxylate |
| SMILES | CC.COC(=O)c1nccnc1NC(=O)c1ccc(OC)c2ccccc12 |
| InChI | InChI=1S/C18H15N3O4.C2H6/c1-24-14-8-7-13(11-5-3-4-6-12(11)14)17(22)21-16-15(18(23)25-2)19-9-10-20-16;1-2/h3-10H,1-2H3,(H,20,21,22);1-2H3 |
| InChIKey | OWCPCPUFJHTYID-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |