C20H34N4O3 — CID 143145283
N-[(7R)-7-butyl-5-[2-(cyclohexen-1-yl)ethyl]-2-formyl-1-methyl-6-oxo-1,2,5-triazocan-3-yl]formamide (PubChem CID 143145283) has the molecular formula C20H34N4O3 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[(7R)-7-butyl-5-[2-(cyclohexen-1-yl)ethyl]-2-formyl-1-methyl-6-oxo-1,2,5-triazocan-3-yl]formamide.
| Compound Name | N-[(7R)-7-butyl-5-[2-(cyclohexen-1-yl)ethyl]-2-formyl-1-methyl-6-oxo-1,2,5-triazocan-3-yl]formamide |
|---|---|
| PubChem CID | 143145283 |
| Molecular Formula | C20H34N4O3 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | N-[(7R)-7-butyl-5-[2-(cyclohexen-1-yl)ethyl]-2-formyl-1-methyl-6-oxo-1,2,5-triazocan-3-yl]formamide |
| SMILES | CCCC[C@@H]1CN(C)N(C=O)C(NC=O)CN(CCC2=CCCCC2)C1=O |
| InChI | InChI=1S/C20H34N4O3/c1-3-4-10-18-13-22(2)24(16-26)19(21-15-25)14-23(20(18)27)12-11-17-8-6-5-7-9-17/h8,15-16,18-19H,3-7,9-14H2,1-2H3,(H,21,25)/t18-,19?/m1/s1 |
| InChIKey | IUKBNMJQKCFEIX-MRTLOADZSA-N |
| XLogP | 1.90 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|