C19H32N4O3 — CID 142956131
N-[2-(cyclohexen-1-yl)ethyl]-N-[(2-formyl-1-methyl-5-oxo-4-propyl-1,2,4-triazinan-3-yl)methyl]acetamide (PubChem CID 142956131) has the molecular formula C19H32N4O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N-[(2-formyl-1-methyl-5-oxo-4-propyl-1,2,4-triazinan-3-yl)methyl]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N-[(2-formyl-1-methyl-5-oxo-4-propyl-1,2,4-triazinan-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 142956131 |
| Molecular Formula | C19H32N4O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N-[(2-formyl-1-methyl-5-oxo-4-propyl-1,2,4-triazinan-3-yl)methyl]acetamide |
| SMILES | CCCN1C(=O)CN(C)N(C=O)C1CN(CCC1=CCCCC1)C(C)=O |
| InChI | InChI=1S/C19H32N4O3/c1-4-11-22-18(23(15-24)20(3)14-19(22)26)13-21(16(2)25)12-10-17-8-6-5-7-9-17/h8,15,18H,4-7,9-14H2,1-3H3 |
| InChIKey | WDMNGZHGFVAFGF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|