C19H30N4O2 — CID 125168724
(6R)-N-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-oxo-N-propyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide (PubChem CID 125168724) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is (6R)-N-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-oxo-N-propyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide.
| Compound Name | (6R)-N-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-oxo-N-propyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 125168724 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | (6R)-N-[2-(cyclohexen-1-yl)ethyl]-2-methyl-3-oxo-N-propyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
| SMILES | CCCN(CCC1=CCCCC1)C(=O)[C@@H]1CCc2nn(C)c(=O)n2C1 |
| InChI | InChI=1S/C19H30N4O2/c1-3-12-22(13-11-15-7-5-4-6-8-15)18(24)16-9-10-17-20-21(2)19(25)23(17)14-16/h7,16H,3-6,8-14H2,1-2H3/t16-/m1/s1 |
| InChIKey | DCCDCXXOYODFGP-MRXNPFEDSA-N |
| XLogP | 2.27 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|