C19H26N4O2 — CID 91843807
N-[2-(cyclohexen-1-yl)ethyl]-N-ethyl-6-(2-hydroxyethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 91843807) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N-ethyl-6-(2-hydroxyethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N-ethyl-6-(2-hydroxyethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 91843807 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N-ethyl-6-(2-hydroxyethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CCN(CCC1=CCCCC1)C(=O)c1cnn2cc(CCO)cnc12 |
| InChI | InChI=1S/C19H26N4O2/c1-2-22(10-8-15-6-4-3-5-7-15)19(25)17-13-21-23-14-16(9-11-24)12-20-18(17)23/h6,12-14,24H,2-5,7-11H2,1H3 |
| InChIKey | RCUJIVTZPOZJME-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|