C25H35N5O3S — CID 143146070
(6S)-N-benzyl-2-methyl-6-(2-methylpropyl)-4,7-dioxo-8-[(3Z)-3-sulfanylhexa-3,5-dienyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 143146070) has the molecular formula C25H35N5O3S and a molecular weight of 485.65 g/mol. Its IUPAC name is (6S)-N-benzyl-2-methyl-6-(2-methylpropyl)-4,7-dioxo-8-[(3Z)-3-sulfanylhexa-3,5-dienyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S)-N-benzyl-2-methyl-6-(2-methylpropyl)-4,7-dioxo-8-[(3Z)-3-sulfanylhexa-3,5-dienyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 143146070 |
| Molecular Formula | C25H35N5O3S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | (6S)-N-benzyl-2-methyl-6-(2-methylpropyl)-4,7-dioxo-8-[(3Z)-3-sulfanylhexa-3,5-dienyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=C/C=C(\S)CCN1CC2N(C(=O)CN(C)N2C(=O)NCc2ccccc2)[C@@H](CC(C)C)C1=O |
| InChI | InChI=1S/C25H35N5O3S/c1-5-9-20(34)12-13-28-16-22-29(21(24(28)32)14-18(2)3)23(31)17-27(4)30(22)25(33)26-15-19-10-7-6-8-11-19/h5-11,18,21-22,34H,1,12-17H2,2-4H3,(H,26,33)/b20-9-/t21-,22?/m0/s1 |
| InChIKey | RQSQUTCTGNYVKW-GSXIRYMNSA-N |
| XLogP | 2.86 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|