C15H23NO5 — CID 143147613
3-[(1-hydroxy-2-methylpropan-2-yl)amino]propyl 4,5-dihydroxy-2-methylbenzoate (PubChem CID 143147613) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is 3-[(1-hydroxy-2-methylpropan-2-yl)amino]propyl 4,5-dihydroxy-2-methylbenzoate.
| Compound Name | 3-[(1-hydroxy-2-methylpropan-2-yl)amino]propyl 4,5-dihydroxy-2-methylbenzoate |
|---|---|
| PubChem CID | 143147613 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 3-[(1-hydroxy-2-methylpropan-2-yl)amino]propyl 4,5-dihydroxy-2-methylbenzoate |
| SMILES | Cc1cc(O)c(O)cc1C(=O)OCCCNC(C)(C)CO |
| InChI | InChI=1S/C15H23NO5/c1-10-7-12(18)13(19)8-11(10)14(20)21-6-4-5-16-15(2,3)9-17/h7-8,16-19H,4-6,9H2,1-3H3 |
| InChIKey | MOBPGQFQZCCEAP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|