C12H13FNO3+ — CID 143149453
[(1Z,3Z)-1-carboxy-5-(4-fluorophenyl)penta-1,3-dienyl]-hydroxyazanium (PubChem CID 143149453) has the molecular formula C12H13FNO3+ and a molecular weight of 238.24 g/mol. Its IUPAC name is [(1Z,3Z)-1-carboxy-5-(4-fluorophenyl)penta-1,3-dienyl]-hydroxyazanium.
| Compound Name | [(1Z,3Z)-1-carboxy-5-(4-fluorophenyl)penta-1,3-dienyl]-hydroxyazanium |
|---|---|
| PubChem CID | 143149453 |
| Molecular Formula | C12H13FNO3+ |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | [(1Z,3Z)-1-carboxy-5-(4-fluorophenyl)penta-1,3-dienyl]-hydroxyazanium |
| SMILES | O=C(O)/C(=C/C=C\Cc1ccc(F)cc1)[NH2+]O |
| InChI | InChI=1S/C12H12FNO3/c13-10-7-5-9(6-8-10)3-1-2-4-11(14-17)12(15)16/h1-2,4-8,14,17H,3H2,(H,15,16)/p+1/b2-1-,11-4- |
| InChIKey | YMFDXWAZORKBQH-GOLXNKMZSA-O |
| XLogP | 0.85 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|