About (6E)-2,2-dimethyl-6-(2-oxoethylidene)-1,3-dioxane-4-carbaldehyde
(6E)-2,2-dimethyl-6-(2-oxoethylidene)-1,3-dioxane-4-carbaldehyde (PubChem CID 143149524) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is (6E)-2,2-dimethyl-6-(2-oxoethylidene)-1,3-dioxane-4-carbaldehyde.
Molecular Properties
| Compound Name | (6E)-2,2-dimethyl-6-(2-oxoethylidene)-1,3-dioxane-4-carbaldehyde |
| PubChem CID | 143149524 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (6E)-2,2-dimethyl-6-(2-oxoethylidene)-1,3-dioxane-4-carbaldehyde |
| SMILES | CC1(C)O/C(=C/C=O)CC(C=O)O1 |
| InChI | InChI=1S/C9H12O4/c1-9(2)12-7(3-4-10)5-8(6-11)13-9/h3-4,6,8H,5H2,1-2H3/b7-3+ |
| InChIKey | MYUIUJDKQPIWGF-XVNBXDOJSA-N |
| XLogP | 0.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (6E)-2,2-dimethyl-6-(2-oxoethylidene)-1,3-dioxane-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-2,2-dimethyl-6-(2-oxoethylidene)-1,3-dioxane-4-carbaldehyde?
The IUPAC name of (6E)-2,2-dimethyl-6-(2-oxoethylidene)-1,3-dioxane-4-carbaldehyde (CID 143149524) is (6E)-2,2-dimethyl-6-(2-oxoethylidene)-1,3-dioxane-4-carbaldehyde.
What is the SMILES notation for (6E)-2,2-dimethyl-6-(2-oxoethylidene)-1,3-dioxane-4-carbaldehyde?
The canonical SMILES for (6E)-2,2-dimethyl-6-(2-oxoethylidene)-1,3-dioxane-4-carbaldehyde is CC1(C)O/C(=C/C=O)CC(C=O)O1.
What is the InChIKey of (6E)-2,2-dimethyl-6-(2-oxoethylidene)-1,3-dioxane-4-carbaldehyde?
The InChIKey is MYUIUJDKQPIWGF-XVNBXDOJSA-N. The full InChI is InChI=1S/C9H12O4/c1-9(2)12-7(3-4-10)5-8(6-11)13-9/h3-4,6,8H,5H2,1-2H3/b7-3+.
What are the key properties of (6E)-2,2-dimethyl-6-(2-oxoethylidene)-1,3-dioxane-4-carbaldehyde?
(6E)-2,2-dimethyl-6-(2-oxoethylidene)-1,3-dioxane-4-carbaldehyde has a molecular weight of 184.19 g/mol, XLogP of 0.81, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-2,2-dimethyl-6-(2-oxoethylidene)-1,3-dioxane-4-carbaldehyde is sourced from PubChem (CID 143149524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).