C13H20O5 — CID 163681235
tert-butyl (2Z)-2-[(6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-ylidene]acetate (PubChem CID 163681235) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is tert-butyl (2Z)-2-[(6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-ylidene]acetate.
| Compound Name | tert-butyl (2Z)-2-[(6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-ylidene]acetate |
|---|---|
| PubChem CID | 163681235 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | tert-butyl (2Z)-2-[(6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-ylidene]acetate |
| SMILES | CC(C)(C)OC(=O)/C=C1/C[C@@H](C=O)OC(C)(C)O1 |
| InChI | InChI=1S/C13H20O5/c1-12(2,3)18-11(15)7-9-6-10(8-14)17-13(4,5)16-9/h7-8,10H,6H2,1-5H3/b9-7-/t10-/m0/s1 |
| InChIKey | JKZVRYBOZQDHMS-RNKPRXRFSA-N |
| XLogP | 1.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|