C10H16O5 — CID 11218185
methyl (E,4R,5R)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate (PubChem CID 11218185) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is methyl (E,4R,5R)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate.
| Compound Name | methyl (E,4R,5R)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate |
|---|---|
| PubChem CID | 11218185 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | methyl (E,4R,5R)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate |
| SMILES | COC(=O)/C=C(/OC)[C@H](C)[C@H](C=O)OC |
| InChI | InChI=1S/C10H16O5/c1-7(9(6-11)14-3)8(13-2)5-10(12)15-4/h5-7,9H,1-4H3/b8-5+/t7-,9-/m0/s1 |
| InChIKey | SAYBZWYDTUFZLV-IFPZVHCUSA-N |
| XLogP | 0.54 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|