C13H22O5 — CID 140698044
ethyl (Z,4S,5R)-5-(3-methoxypropoxy)-4-methyl-6-oxohex-2-enoate (PubChem CID 140698044) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is ethyl (Z,4S,5R)-5-(3-methoxypropoxy)-4-methyl-6-oxohex-2-enoate.
| Compound Name | ethyl (Z,4S,5R)-5-(3-methoxypropoxy)-4-methyl-6-oxohex-2-enoate |
|---|---|
| PubChem CID | 140698044 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | ethyl (Z,4S,5R)-5-(3-methoxypropoxy)-4-methyl-6-oxohex-2-enoate |
| SMILES | CCOC(=O)/C=C\[C@H](C)[C@H](C=O)OCCCOC |
| InChI | InChI=1S/C13H22O5/c1-4-17-13(15)7-6-11(2)12(10-14)18-9-5-8-16-3/h6-7,10-12H,4-5,8-9H2,1-3H3/b7-6-/t11-,12-/m0/s1 |
| InChIKey | IOMBPEFPXVKLBJ-MVSYMCDOSA-N |
| XLogP | 1.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|