C11H18O4 — CID 11506756
ethyl (E,6S)-6-methoxy-2-methyl-7-oxohept-2-enoate (PubChem CID 11506756) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is ethyl (E,6S)-6-methoxy-2-methyl-7-oxohept-2-enoate.
| Compound Name | ethyl (E,6S)-6-methoxy-2-methyl-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 11506756 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | ethyl (E,6S)-6-methoxy-2-methyl-7-oxohept-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/CC[C@@H](C=O)OC |
| InChI | InChI=1S/C11H18O4/c1-4-15-11(13)9(2)6-5-7-10(8-12)14-3/h6,8,10H,4-5,7H2,1-3H3/b9-6+/t10-/m0/s1 |
| InChIKey | RMFIMAKVJBLLCM-ZKXNXJMVSA-N |
| XLogP | 1.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|