C12H16O5 — CID 11379461
(E,2R)-2-(methoxymethoxy)-2-methyl-4-[(2R)-6-oxo-2,3-dihydropyran-2-yl]but-3-enal (PubChem CID 11379461) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is (E,2R)-2-(methoxymethoxy)-2-methyl-4-[(2R)-6-oxo-2,3-dihydropyran-2-yl]but-3-enal.
| Compound Name | (E,2R)-2-(methoxymethoxy)-2-methyl-4-[(2R)-6-oxo-2,3-dihydropyran-2-yl]but-3-enal |
|---|---|
| PubChem CID | 11379461 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (E,2R)-2-(methoxymethoxy)-2-methyl-4-[(2R)-6-oxo-2,3-dihydropyran-2-yl]but-3-enal |
| SMILES | COCO[C@@](C)(C=O)/C=C/[C@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C12H16O5/c1-12(8-13,16-9-15-2)7-6-10-4-3-5-11(14)17-10/h3,5-8,10H,4,9H2,1-2H3/b7-6+/t10-,12-/m1/s1 |
| InChIKey | HUTWNUDXRCURAV-PWBFPFQSSA-N |
| XLogP | 0.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|