(6,6-dimethyl-5-oxo-2H-pyran-2-yl) acetate

C9H12O4 — CID 12042631

IUPAC(6,6-dimethyl-5-oxo-2H-pyran-2-yl) acetate
SMILESCC(=O)OC1C=CC(=O)C(C)(C)O1
InChIInChI=1S/C9H12O4/c1-6(10)12-8-5-4-7(11)9(2,3)13-8/h4-5,8H,1-3H3
InChIKeyLYBCHOATZZWYGP-UHFFFAOYSA-N
MW184.19 g/mol
LogP0.81
Rot. Bonds1

About (6,6-dimethyl-5-oxo-2H-pyran-2-yl) acetate

(6,6-dimethyl-5-oxo-2H-pyran-2-yl) acetate (PubChem CID 12042631) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is (6,6-dimethyl-5-oxo-2H-pyran-2-yl) acetate.

Molecular Properties

Compound Name(6,6-dimethyl-5-oxo-2H-pyran-2-yl) acetate
PubChem CID12042631
Molecular FormulaC9H12O4
Molecular Weight184.19 g/mol
Exact Mass184.07
IUPAC Name(6,6-dimethyl-5-oxo-2H-pyran-2-yl) acetate
SMILESCC(=O)OC1C=CC(=O)C(C)(C)O1
InChIInChI=1S/C9H12O4/c1-6(10)12-8-5-4-7(11)9(2,3)13-8/h4-5,8H,1-3H3
InChIKeyLYBCHOATZZWYGP-UHFFFAOYSA-N
XLogP0.81
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.19
LogP ≤ 50.81
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (6,6-dimethyl-5-oxo-2H-pyran-2-yl) acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6,6-dimethyl-5-oxo-2H-pyran-2-yl) acetate?
The IUPAC name of (6,6-dimethyl-5-oxo-2H-pyran-2-yl) acetate (CID 12042631) is (6,6-dimethyl-5-oxo-2H-pyran-2-yl) acetate.
What is the SMILES notation for (6,6-dimethyl-5-oxo-2H-pyran-2-yl) acetate?
The canonical SMILES for (6,6-dimethyl-5-oxo-2H-pyran-2-yl) acetate is CC(=O)OC1C=CC(=O)C(C)(C)O1.
What is the InChIKey of (6,6-dimethyl-5-oxo-2H-pyran-2-yl) acetate?
The InChIKey is LYBCHOATZZWYGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-6(10)12-8-5-4-7(11)9(2,3)13-8/h4-5,8H,1-3H3.
What are the key properties of (6,6-dimethyl-5-oxo-2H-pyran-2-yl) acetate?
(6,6-dimethyl-5-oxo-2H-pyran-2-yl) acetate has a molecular weight of 184.19 g/mol, XLogP of 0.81, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6,6-dimethyl-5-oxo-2H-pyran-2-yl) acetate is sourced from PubChem (CID 12042631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).