About tert-butyl [(2S,6R)-6-methyl-5-oxo-2H-pyran-2-yl] carbonate
tert-butyl [(2S,6R)-6-methyl-5-oxo-2H-pyran-2-yl] carbonate (PubChem CID 11961824) has the molecular formula C11H16O5
and a molecular weight of 228.24 g/mol. Its IUPAC name is tert-butyl [(2S,6R)-6-methyl-5-oxo-2H-pyran-2-yl] carbonate.
Analyze tert-butyl [(2S,6R)-6-methyl-5-oxo-2H-pyran-2-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl [(2S,6R)-6-methyl-5-oxo-2H-pyran-2-yl] carbonate?
The IUPAC name of tert-butyl [(2S,6R)-6-methyl-5-oxo-2H-pyran-2-yl] carbonate (CID 11961824) is tert-butyl [(2S,6R)-6-methyl-5-oxo-2H-pyran-2-yl] carbonate.
What is the SMILES notation for tert-butyl [(2S,6R)-6-methyl-5-oxo-2H-pyran-2-yl] carbonate?
The canonical SMILES for tert-butyl [(2S,6R)-6-methyl-5-oxo-2H-pyran-2-yl] carbonate is C[C@H]1O[C@@H](OC(=O)OC(C)(C)C)C=CC1=O.
What is the InChIKey of tert-butyl [(2S,6R)-6-methyl-5-oxo-2H-pyran-2-yl] carbonate?
The InChIKey is LGVZLQALXYJODJ-APPZFPTMSA-N. The full InChI is InChI=1S/C11H16O5/c1-7-8(12)5-6-9(14-7)15-10(13)16-11(2,3)4/h5-7,9H,1-4H3/t7-,9+/m1/s1.
What are the key properties of tert-butyl [(2S,6R)-6-methyl-5-oxo-2H-pyran-2-yl] carbonate?
tert-butyl [(2S,6R)-6-methyl-5-oxo-2H-pyran-2-yl] carbonate has a molecular weight of 228.24 g/mol, XLogP of 1.81, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl [(2S,6R)-6-methyl-5-oxo-2H-pyran-2-yl] carbonate is sourced from PubChem (CID 11961824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).