methyl (E,4S,5S)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate

C10H16O5 — CID 11401654

IUPACmethyl (E,4S,5S)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate
SMILESCOC(=O)/C=C(/OC)[C@@H](C)[C@@H](C=O)OC
InChIInChI=1S/C10H16O5/c1-7(9(6-11)14-3)8(13-2)5-10(12)15-4/h5-7,9H,1-4H3/b8-5+/t7-,9-/m1/s1
InChIKeySAYBZWYDTUFZLV-DAAJKXQRSA-N
MW216.23 g/mol
LogP0.54
Rot. Bonds6

About methyl (E,4S,5S)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate

methyl (E,4S,5S)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate (PubChem CID 11401654) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is methyl (E,4S,5S)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate.

Molecular Properties

Compound Namemethyl (E,4S,5S)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate
PubChem CID11401654
Molecular FormulaC10H16O5
Molecular Weight216.23 g/mol
Exact Mass216.10
IUPAC Namemethyl (E,4S,5S)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate
SMILESCOC(=O)/C=C(/OC)[C@@H](C)[C@@H](C=O)OC
InChIInChI=1S/C10H16O5/c1-7(9(6-11)14-3)8(13-2)5-10(12)15-4/h5-7,9H,1-4H3/b8-5+/t7-,9-/m1/s1
InChIKeySAYBZWYDTUFZLV-DAAJKXQRSA-N
XLogP0.54
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.23
LogP ≤ 50.54
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (E,4S,5S)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (E,4S,5S)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate?
The IUPAC name of methyl (E,4S,5S)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate (CID 11401654) is methyl (E,4S,5S)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate.
What is the SMILES notation for methyl (E,4S,5S)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate?
The canonical SMILES for methyl (E,4S,5S)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate is COC(=O)/C=C(/OC)[C@@H](C)[C@@H](C=O)OC.
What is the InChIKey of methyl (E,4S,5S)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate?
The InChIKey is SAYBZWYDTUFZLV-DAAJKXQRSA-N. The full InChI is InChI=1S/C10H16O5/c1-7(9(6-11)14-3)8(13-2)5-10(12)15-4/h5-7,9H,1-4H3/b8-5+/t7-,9-/m1/s1.
What are the key properties of methyl (E,4S,5S)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate?
methyl (E,4S,5S)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate has a molecular weight of 216.23 g/mol, XLogP of 0.54, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E,4S,5S)-3,5-dimethoxy-4-methyl-6-oxohex-2-enoate is sourced from PubChem (CID 11401654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).