C17H18FN5O4 — CID 143150151
N-[(4-fluorophenyl)methyl]-7-hydroxy-3,6-dioxo-2-propyl-1,4-dihydropyrimido[2,1-c][1,2,4]triazine-8-carboxamide (PubChem CID 143150151) has the molecular formula C17H18FN5O4 and a molecular weight of 375.36 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-7-hydroxy-3,6-dioxo-2-propyl-1,4-dihydropyrimido[2,1-c][1,2,4]triazine-8-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-7-hydroxy-3,6-dioxo-2-propyl-1,4-dihydropyrimido[2,1-c][1,2,4]triazine-8-carboxamide |
|---|---|
| PubChem CID | 143150151 |
| Molecular Formula | C17H18FN5O4 |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-7-hydroxy-3,6-dioxo-2-propyl-1,4-dihydropyrimido[2,1-c][1,2,4]triazine-8-carboxamide |
| SMILES | CCCN1Nc2nc(C(=O)NCc3ccc(F)cc3)c(O)c(=O)n2CC1=O |
| InChI | InChI=1S/C17H18FN5O4/c1-2-7-23-12(24)9-22-16(27)14(25)13(20-17(22)21-23)15(26)19-8-10-3-5-11(18)6-4-10/h3-6,25H,2,7-9H2,1H3,(H,19,26)(H,20,21) |
| InChIKey | WIYXKTDNRCHARL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |