C18H21FN4O3 — CID 54684170
N-[(4-fluorophenyl)methyl]-3-hydroxy-10,10-dimethyl-4-oxo-6,7,8,9-tetrahydropyrimido[1,2-d][1,4]diazepine-2-carboxamide (PubChem CID 54684170) has the molecular formula C18H21FN4O3 and a molecular weight of 360.39 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-hydroxy-10,10-dimethyl-4-oxo-6,7,8,9-tetrahydropyrimido[1,2-d][1,4]diazepine-2-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-hydroxy-10,10-dimethyl-4-oxo-6,7,8,9-tetrahydropyrimido[1,2-d][1,4]diazepine-2-carboxamide |
|---|---|
| PubChem CID | 54684170 |
| Molecular Formula | C18H21FN4O3 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-hydroxy-10,10-dimethyl-4-oxo-6,7,8,9-tetrahydropyrimido[1,2-d][1,4]diazepine-2-carboxamide |
| SMILES | CC1(C)CNCCn2c1nc(C(=O)NCc1ccc(F)cc1)c(O)c2=O |
| InChI | InChI=1S/C18H21FN4O3/c1-18(2)10-20-7-8-23-16(26)14(24)13(22-17(18)23)15(25)21-9-11-3-5-12(19)6-4-11/h3-6,20,24H,7-10H2,1-2H3,(H,21,25) |
| InChIKey | IMVCTGRIQNOITO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |