C19H20FN3O6S — CID 54682717
N-[(4-fluorophenyl)methyl]-3-hydroxy-4,8,8-trioxospiro[6,7-dihydropyrimido[2,1-c][1,4]thiazine-9,4'-oxane]-2-carboxamide (PubChem CID 54682717) has the molecular formula C19H20FN3O6S and a molecular weight of 437.45 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-hydroxy-4,8,8-trioxospiro[6,7-dihydropyrimido[2,1-c][1,4]thiazine-9,4'-oxane]-2-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-hydroxy-4,8,8-trioxospiro[6,7-dihydropyrimido[2,1-c][1,4]thiazine-9,4'-oxane]-2-carboxamide |
|---|---|
| PubChem CID | 54682717 |
| Molecular Formula | C19H20FN3O6S |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-hydroxy-4,8,8-trioxospiro[6,7-dihydropyrimido[2,1-c][1,4]thiazine-9,4'-oxane]-2-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1nc2n(c(=O)c1O)CCS(=O)(=O)C21CCOCC1 |
| InChI | InChI=1S/C19H20FN3O6S/c20-13-3-1-12(2-4-13)11-21-16(25)14-15(24)17(26)23-7-10-30(27,28)19(18(23)22-14)5-8-29-9-6-19/h1-4,24H,5-11H2,(H,21,25) |
| InChIKey | GUPYSGZXHILFHX-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |