C29H46O7 — CID 143150270
2-[(5S,11E,13E)-16-ethyl-15-[[(4R)-4-methoxy-6-methyloxan-2-yl]oxymethyl]-5,13-dimethyl-2,10-dioxo-1-oxacyclohexadeca-11,13-dien-7-yl]acetaldehyde (PubChem CID 143150270) has the molecular formula C29H46O7 and a molecular weight of 506.68 g/mol. Its IUPAC name is 2-[(5S,11E,13E)-16-ethyl-15-[[(4R)-4-methoxy-6-methyloxan-2-yl]oxymethyl]-5,13-dimethyl-2,10-dioxo-1-oxacyclohexadeca-11,13-dien-7-yl]acetaldehyde.
| Compound Name | 2-[(5S,11E,13E)-16-ethyl-15-[[(4R)-4-methoxy-6-methyloxan-2-yl]oxymethyl]-5,13-dimethyl-2,10-dioxo-1-oxacyclohexadeca-11,13-dien-7-yl]acetaldehyde |
|---|---|
| PubChem CID | 143150270 |
| Molecular Formula | C29H46O7 |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | 2-[(5S,11E,13E)-16-ethyl-15-[[(4R)-4-methoxy-6-methyloxan-2-yl]oxymethyl]-5,13-dimethyl-2,10-dioxo-1-oxacyclohexadeca-11,13-dien-7-yl]acetaldehyde |
| SMILES | CCC1OC(=O)CC[C@H](C)CC(CC=O)CCC(=O)/C=C/C(C)=C/C1COC1C[C@H](OC)CC(C)O1 |
| InChI | InChI=1S/C29H46O7/c1-6-27-24(19-34-29-18-26(33-5)17-22(4)35-29)16-21(3)7-10-25(31)11-9-23(13-14-30)15-20(2)8-12-28(32)36-27/h7,10,14,16,20,22-24,26-27,29H,6,8-9,11-13,15,17-19H2,1-5H3/b10-7+,21-16+/t20-,22?,23?,24?,26+,27?,29?/m0/s1 |
| InChIKey | LVCXVJQEHLQYAW-USWIBQLOSA-N |
| XLogP | 5.36 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|