C20H23N3O5S — CID 143151767
2,3-dihydroxypropyl 2-benzamido-3-(methyliminomethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate (PubChem CID 143151767) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-benzamido-3-(methyliminomethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate.
| Compound Name | 2,3-dihydroxypropyl 2-benzamido-3-(methyliminomethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 143151767 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2,3-dihydroxypropyl 2-benzamido-3-(methyliminomethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
| SMILES | C/N=C/c1c(NC(=O)c2ccccc2)sc2c1CCN(C(=O)OCC(O)CO)C2 |
| InChI | InChI=1S/C20H23N3O5S/c1-21-9-16-15-7-8-23(20(27)28-12-14(25)11-24)10-17(15)29-19(16)22-18(26)13-5-3-2-4-6-13/h2-6,9,14,24-25H,7-8,10-12H2,1H3,(H,22,26)/b21-9+ |
| InChIKey | FJFWRLVOYDVXBG-ZVBGSRNCSA-N |
| XLogP | 1.90 |
| TPSA | 111.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|