C21H27N3O5S — CID 163627149
3-(furan-2-yl)-N-[6-[2-(2-methoxyethoxy)acetyl]-3-(methyliminomethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]propanamide (PubChem CID 163627149) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[6-[2-(2-methoxyethoxy)acetyl]-3-(methyliminomethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]propanamide.
| Compound Name | 3-(furan-2-yl)-N-[6-[2-(2-methoxyethoxy)acetyl]-3-(methyliminomethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]propanamide |
|---|---|
| PubChem CID | 163627149 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 3-(furan-2-yl)-N-[6-[2-(2-methoxyethoxy)acetyl]-3-(methyliminomethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]propanamide |
| SMILES | C/N=C/c1c(NC(=O)CCc2ccco2)sc2c1CCN(C(=O)COCCOC)C2 |
| InChI | InChI=1S/C21H27N3O5S/c1-22-12-17-16-7-8-24(20(26)14-28-11-10-27-2)13-18(16)30-21(17)23-19(25)6-5-15-4-3-9-29-15/h3-4,9,12H,5-8,10-11,13-14H2,1-2H3,(H,23,25)/b22-12+ |
| InChIKey | HSZPECCOZMOVFI-WSDLNYQXSA-N |
| XLogP | 2.51 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|