C22H20F3N3O3 — CID 143152363
N-cyclohexyl-2-nitro-4-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]aniline (PubChem CID 143152363) has the molecular formula C22H20F3N3O3 and a molecular weight of 431.41 g/mol. Its IUPAC name is N-cyclohexyl-2-nitro-4-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]aniline.
| Compound Name | N-cyclohexyl-2-nitro-4-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]aniline |
|---|---|
| PubChem CID | 143152363 |
| Molecular Formula | C22H20F3N3O3 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | N-cyclohexyl-2-nitro-4-[5-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]aniline |
| SMILES | O=[N+]([O-])c1cc(-c2ncc(-c3ccc(C(F)(F)F)cc3)o2)ccc1NC1CCCCC1 |
| InChI | InChI=1S/C22H20F3N3O3/c23-22(24,25)16-9-6-14(7-10-16)20-13-26-21(31-20)15-8-11-18(19(12-15)28(29)30)27-17-4-2-1-3-5-17/h6-13,17,27H,1-5H2 |
| InChIKey | AIEATFKXOPAZBW-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|