C29H37FN4O4S — CID 143153798
N-[(2Z,4E)-6-(2-amino-N-ethylanilino)-2-sulfanylhexa-2,4-dienyl]-4-[2-(4-fluorophenyl)piperidin-1-yl]-2,3-dihydroxy-4-oxobutanamide (PubChem CID 143153798) has the molecular formula C29H37FN4O4S and a molecular weight of 556.70 g/mol. Its IUPAC name is N-[(2Z,4E)-6-(2-amino-N-ethylanilino)-2-sulfanylhexa-2,4-dienyl]-4-[2-(4-fluorophenyl)piperidin-1-yl]-2,3-dihydroxy-4-oxobutanamide.
| Compound Name | N-[(2Z,4E)-6-(2-amino-N-ethylanilino)-2-sulfanylhexa-2,4-dienyl]-4-[2-(4-fluorophenyl)piperidin-1-yl]-2,3-dihydroxy-4-oxobutanamide |
|---|---|
| PubChem CID | 143153798 |
| Molecular Formula | C29H37FN4O4S |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | N-[(2Z,4E)-6-(2-amino-N-ethylanilino)-2-sulfanylhexa-2,4-dienyl]-4-[2-(4-fluorophenyl)piperidin-1-yl]-2,3-dihydroxy-4-oxobutanamide |
| SMILES | CCN(C/C=C/C=C(\S)CNC(=O)C(O)C(O)C(=O)N1CCCCC1c1ccc(F)cc1)c1ccccc1N |
| InChI | InChI=1S/C29H37FN4O4S/c1-2-33(25-12-4-3-10-23(25)31)17-7-5-9-22(39)19-32-28(37)26(35)27(36)29(38)34-18-8-6-11-24(34)20-13-15-21(30)16-14-20/h3-5,7,9-10,12-16,24,26-27,35-36,39H,2,6,8,11,17-19,31H2,1H3,(H,32,37)/b7-5+,22-9- |
| InChIKey | NFZJAYVWSPBNPN-JKFAUIACSA-N |
| XLogP | 3.20 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|