C18H29N3O4S — CID 143154070
2,3-dihydroxy-N-[3-[(Z)-prop-1-enyl]sulfanylpropyl]-N'-(pyridin-3-ylmethyl)butanediamide;ethane (PubChem CID 143154070) has the molecular formula C18H29N3O4S and a molecular weight of 383.51 g/mol. Its IUPAC name is 2,3-dihydroxy-N-[3-[(Z)-prop-1-enyl]sulfanylpropyl]-N'-(pyridin-3-ylmethyl)butanediamide;ethane.
| Compound Name | 2,3-dihydroxy-N-[3-[(Z)-prop-1-enyl]sulfanylpropyl]-N'-(pyridin-3-ylmethyl)butanediamide;ethane |
|---|---|
| PubChem CID | 143154070 |
| Molecular Formula | C18H29N3O4S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 2,3-dihydroxy-N-[3-[(Z)-prop-1-enyl]sulfanylpropyl]-N'-(pyridin-3-ylmethyl)butanediamide;ethane |
| SMILES | C/C=C\SCCCNC(=O)C(O)C(O)C(=O)NCc1cccnc1.CC |
| InChI | InChI=1S/C16H23N3O4S.C2H6/c1-2-8-24-9-4-7-18-15(22)13(20)14(21)16(23)19-11-12-5-3-6-17-10-12;1-2/h2-3,5-6,8,10,13-14,20-21H,4,7,9,11H2,1H3,(H,18,22)(H,19,23);1-2H3/b8-2-; |
| InChIKey | YYRUHGHEONMMKZ-WENINEFDSA-N |
| XLogP | 1.22 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|