C17H18FNO4S — CID 143154177
N-[2-[4-[(2-fluorophenyl)methyl]thiophen-2-yl]ethyl]-2,3-dihydroxy-4-oxobutanamide (PubChem CID 143154177) has the molecular formula C17H18FNO4S and a molecular weight of 351.40 g/mol. Its IUPAC name is N-[2-[4-[(2-fluorophenyl)methyl]thiophen-2-yl]ethyl]-2,3-dihydroxy-4-oxobutanamide.
| Compound Name | N-[2-[4-[(2-fluorophenyl)methyl]thiophen-2-yl]ethyl]-2,3-dihydroxy-4-oxobutanamide |
|---|---|
| PubChem CID | 143154177 |
| Molecular Formula | C17H18FNO4S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-[2-[4-[(2-fluorophenyl)methyl]thiophen-2-yl]ethyl]-2,3-dihydroxy-4-oxobutanamide |
| SMILES | O=CC(O)C(O)C(=O)NCCc1cc(Cc2ccccc2F)cs1 |
| InChI | InChI=1S/C17H18FNO4S/c18-14-4-2-1-3-12(14)7-11-8-13(24-10-11)5-6-19-17(23)16(22)15(21)9-20/h1-4,8-10,15-16,21-22H,5-7H2,(H,19,23) |
| InChIKey | LRZSZZMQDXEHSU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|