C17H20N2O4S — CID 70330618
(2R,3R)-N'-[2-(4-benzylthiophen-2-yl)ethyl]-2,3-dihydroxybutanediamide (PubChem CID 70330618) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is (2R,3R)-N'-[2-(4-benzylthiophen-2-yl)ethyl]-2,3-dihydroxybutanediamide.
| Compound Name | (2R,3R)-N'-[2-(4-benzylthiophen-2-yl)ethyl]-2,3-dihydroxybutanediamide |
|---|---|
| PubChem CID | 70330618 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (2R,3R)-N'-[2-(4-benzylthiophen-2-yl)ethyl]-2,3-dihydroxybutanediamide |
| SMILES | NC(=O)[C@H](O)[C@@H](O)C(=O)NCCc1cc(Cc2ccccc2)cs1 |
| InChI | InChI=1S/C17H20N2O4S/c18-16(22)14(20)15(21)17(23)19-7-6-13-9-12(10-24-13)8-11-4-2-1-3-5-11/h1-5,9-10,14-15,20-21H,6-8H2,(H2,18,22)(H,19,23)/t14-,15-/m1/s1 |
| InChIKey | LRPNSBVNWVKERV-HUUCEWRRSA-N |
| XLogP | 0.20 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |