C27H31F3N2O4S — CID 143155378
N-[[4-[(3Z,5E)-5,7-difluoroocta-3,5,7-trienyl]thiophen-2-yl]methyl]-4-[2-(4-fluorocyclohexa-2,4-dien-1-yl)pyrrolidin-1-yl]-2,3-dihydroxy-4-oxobutanamide (PubChem CID 143155378) has the molecular formula C27H31F3N2O4S and a molecular weight of 536.62 g/mol. Its IUPAC name is N-[[4-[(3Z,5E)-5,7-difluoroocta-3,5,7-trienyl]thiophen-2-yl]methyl]-4-[2-(4-fluorocyclohexa-2,4-dien-1-yl)pyrrolidin-1-yl]-2,3-dihydroxy-4-oxobutanamide.
| Compound Name | N-[[4-[(3Z,5E)-5,7-difluoroocta-3,5,7-trienyl]thiophen-2-yl]methyl]-4-[2-(4-fluorocyclohexa-2,4-dien-1-yl)pyrrolidin-1-yl]-2,3-dihydroxy-4-oxobutanamide |
|---|---|
| PubChem CID | 143155378 |
| Molecular Formula | C27H31F3N2O4S |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | N-[[4-[(3Z,5E)-5,7-difluoroocta-3,5,7-trienyl]thiophen-2-yl]methyl]-4-[2-(4-fluorocyclohexa-2,4-dien-1-yl)pyrrolidin-1-yl]-2,3-dihydroxy-4-oxobutanamide |
| SMILES | C=C(F)/C=C(F)\C=C/CCc1csc(CNC(=O)C(O)C(O)C(=O)N2CCCC2C2C=CC(F)=CC2)c1 |
| InChI | InChI=1S/C27H31F3N2O4S/c1-17(28)13-21(30)6-3-2-5-18-14-22(37-16-18)15-31-26(35)24(33)25(34)27(36)32-12-4-7-23(32)19-8-10-20(29)11-9-19/h3,6,8,10-11,13-14,16,19,23-25,33-34H,1-2,4-5,7,9,12,15H2,(H,31,35)/b6-3-,21-13+ |
| InChIKey | GNRMBTIGQMKEKZ-BYMMXNDZSA-N |
| XLogP | 4.33 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|