C13H25NO — CID 14315763
(Z)-5-(cyclohexylamino)-2,4-dimethylpent-3-en-2-ol (PubChem CID 14315763) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is (Z)-5-(cyclohexylamino)-2,4-dimethylpent-3-en-2-ol.
| Compound Name | (Z)-5-(cyclohexylamino)-2,4-dimethylpent-3-en-2-ol |
|---|---|
| PubChem CID | 14315763 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (Z)-5-(cyclohexylamino)-2,4-dimethylpent-3-en-2-ol |
| SMILES | C/C(=C/C(C)(C)O)CNC1CCCCC1 |
| InChI | InChI=1S/C13H25NO/c1-11(9-13(2,3)15)10-14-12-7-5-4-6-8-12/h9,12,14-15H,4-8,10H2,1-3H3/b11-9- |
| InChIKey | RRJKLIOJDGOUDD-LUAWRHEFSA-N |
| XLogP | 2.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|