C14H24N2 — CID 143157640
ethane;(7Z)-7-[(ethylideneamino)methylidene]cyclohepta-2,5-dien-1-imine (PubChem CID 143157640) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is ethane;(7Z)-7-[(ethylideneamino)methylidene]cyclohepta-2,5-dien-1-imine.
| Compound Name | ethane;(7Z)-7-[(ethylideneamino)methylidene]cyclohepta-2,5-dien-1-imine |
|---|---|
| PubChem CID | 143157640 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | ethane;(7Z)-7-[(ethylideneamino)methylidene]cyclohepta-2,5-dien-1-imine |
| SMILES | CC.CC.[H]/N=C1\C=CCC=C\C1=C\N=C\C |
| InChI | InChI=1S/C10H12N2.2C2H6/c1-2-12-8-9-6-4-3-5-7-10(9)11;2*1-2/h2,4-8,11H,3H2,1H3;2*1-2H3/b9-8-,11-10+,12-2+;; |
| InChIKey | JLOMYAOBXVKDKC-HCXYCOPYSA-N |
| XLogP | 4.55 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|