C8H12N2O — CID 143158240
N-[2-(prop-2-enylideneamino)prop-2-enyl]acetamide (PubChem CID 143158240) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is N-[2-(prop-2-enylideneamino)prop-2-enyl]acetamide.
| Compound Name | N-[2-(prop-2-enylideneamino)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 143158240 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | N-[2-(prop-2-enylideneamino)prop-2-enyl]acetamide |
| SMILES | C=C/C=N/C(=C)CNC(C)=O |
| InChI | InChI=1S/C8H12N2O/c1-4-5-9-7(2)6-10-8(3)11/h4-5H,1-2,6H2,3H3,(H,10,11)/b9-5+ |
| InChIKey | LJGHADWAIASXDK-WEVVVXLNSA-N |
| XLogP | 0.89 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|