C16H23N3 — CID 143158754
N,6-dimethyl-N-(3-methylphenyl)pyrimidin-4-amine;propane (PubChem CID 143158754) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is N,6-dimethyl-N-(3-methylphenyl)pyrimidin-4-amine;propane.
| Compound Name | N,6-dimethyl-N-(3-methylphenyl)pyrimidin-4-amine;propane |
|---|---|
| PubChem CID | 143158754 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | N,6-dimethyl-N-(3-methylphenyl)pyrimidin-4-amine;propane |
| SMILES | CCC.Cc1cccc(N(C)c2cc(C)ncn2)c1 |
| InChI | InChI=1S/C13H15N3.C3H8/c1-10-5-4-6-12(7-10)16(3)13-8-11(2)14-9-15-13;1-3-2/h4-9H,1-3H3;3H2,1-2H3 |
| InChIKey | SWQCIZAOXCSQAH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |