C13H15N3 — CID 143158755
N,6-dimethyl-N-(3-methylphenyl)pyrimidin-4-amine (PubChem CID 143158755) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is N,6-dimethyl-N-(3-methylphenyl)pyrimidin-4-amine.
| Compound Name | N,6-dimethyl-N-(3-methylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 143158755 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N,6-dimethyl-N-(3-methylphenyl)pyrimidin-4-amine |
| SMILES | Cc1cccc(N(C)c2cc(C)ncn2)c1 |
| InChI | InChI=1S/C13H15N3/c1-10-5-4-6-12(7-10)16(3)13-8-11(2)14-9-15-13/h4-9H,1-3H3 |
| InChIKey | KORIMGONMVFSSO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |