C8H16N2 — CID 143160390
N,N'-dimethyl-N-(3-methylbut-2-en-2-yl)methanimidamide (PubChem CID 143160390) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is N,N'-dimethyl-N-(3-methylbut-2-en-2-yl)methanimidamide.
| Compound Name | N,N'-dimethyl-N-(3-methylbut-2-en-2-yl)methanimidamide |
|---|---|
| PubChem CID | 143160390 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | N,N'-dimethyl-N-(3-methylbut-2-en-2-yl)methanimidamide |
| SMILES | C/N=C/N(C)C(C)=C(C)C |
| InChI | InChI=1S/C8H16N2/c1-7(2)8(3)10(5)6-9-4/h6H,1-5H3/b9-6+ |
| InChIKey | RHRGBTDJZLIPRY-RMKNXTFCSA-N |
| XLogP | 1.89 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|