C21H31N5OS — CID 143160397
13-(dimethylamino)-5-ethyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one;1-ethylazepane (PubChem CID 143160397) has the molecular formula C21H31N5OS and a molecular weight of 401.58 g/mol. Its IUPAC name is 13-(dimethylamino)-5-ethyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one;1-ethylazepane.
| Compound Name | 13-(dimethylamino)-5-ethyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one;1-ethylazepane |
|---|---|
| PubChem CID | 143160397 |
| Molecular Formula | C21H31N5OS |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 13-(dimethylamino)-5-ethyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one;1-ethylazepane |
| SMILES | CCN1CCCCCC1.CCn1cnc2c(sc3nccc(N(C)C)c32)c1=O |
| InChI | InChI=1S/C13H14N4OS.C8H17N/c1-4-17-7-15-10-9-8(16(2)3)5-6-14-12(9)19-11(10)13(17)18;1-2-9-7-5-3-4-6-8-9/h5-7H,4H2,1-3H3;2-8H2,1H3 |
| InChIKey | ZZINNVFMCNDZKO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |