C18H16ClN5OS — CID 89048499
5-[(3-amino-4-chlorophenyl)methyl]-13-(dimethylamino)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 89048499) has the molecular formula C18H16ClN5OS and a molecular weight of 385.88 g/mol. Its IUPAC name is 5-[(3-amino-4-chlorophenyl)methyl]-13-(dimethylamino)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 5-[(3-amino-4-chlorophenyl)methyl]-13-(dimethylamino)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 89048499 |
| Molecular Formula | C18H16ClN5OS |
| Molecular Weight | 385.88 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 5-[(3-amino-4-chlorophenyl)methyl]-13-(dimethylamino)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | CN(C)c1ccnc2sc3c(=O)n(Cc4ccc(Cl)c(N)c4)cnc3c12 |
| InChI | InChI=1S/C18H16ClN5OS/c1-23(2)13-5-6-21-17-14(13)15-16(26-17)18(25)24(9-22-15)8-10-3-4-11(19)12(20)7-10/h3-7,9H,8,20H2,1-2H3 |
| InChIKey | VNUKSKNKGVTVTG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.88 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|