C24H23NO4 — CID 143161484
1'-[2-methyl-2-(4-prop-2-ynylphenoxy)propanoyl]spiro[2-benzofuran-3,3'-pyrrolidine]-1-one (PubChem CID 143161484) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is 1'-[2-methyl-2-(4-prop-2-ynylphenoxy)propanoyl]spiro[2-benzofuran-3,3'-pyrrolidine]-1-one.
| Compound Name | 1'-[2-methyl-2-(4-prop-2-ynylphenoxy)propanoyl]spiro[2-benzofuran-3,3'-pyrrolidine]-1-one |
|---|---|
| PubChem CID | 143161484 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 1'-[2-methyl-2-(4-prop-2-ynylphenoxy)propanoyl]spiro[2-benzofuran-3,3'-pyrrolidine]-1-one |
| SMILES | C#CCc1ccc(OC(C)(C)C(=O)N2CCC3(C2)OC(=O)c2ccccc23)cc1 |
| InChI | InChI=1S/C24H23NO4/c1-4-7-17-10-12-18(13-11-17)28-23(2,3)22(27)25-15-14-24(16-25)20-9-6-5-8-19(20)21(26)29-24/h1,5-6,8-13H,7,14-16H2,2-3H3 |
| InChIKey | PFTVMRPCXKUIMT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|