C14H13IN4O — CID 143163469
4-(1-phenyltriazol-4-yl)-3,6-dihydro-2H-pyridine-1-carbonyl iodide (PubChem CID 143163469) has the molecular formula C14H13IN4O and a molecular weight of 380.19 g/mol. Its IUPAC name is 4-(1-phenyltriazol-4-yl)-3,6-dihydro-2H-pyridine-1-carbonyl iodide.
| Compound Name | 4-(1-phenyltriazol-4-yl)-3,6-dihydro-2H-pyridine-1-carbonyl iodide |
|---|---|
| PubChem CID | 143163469 |
| Molecular Formula | C14H13IN4O |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | 4-(1-phenyltriazol-4-yl)-3,6-dihydro-2H-pyridine-1-carbonyl iodide |
| SMILES | O=C(I)N1CC=C(c2cn(-c3ccccc3)nn2)CC1 |
| InChI | InChI=1S/C14H13IN4O/c15-14(20)18-8-6-11(7-9-18)13-10-19(17-16-13)12-4-2-1-3-5-12/h1-6,10H,7-9H2 |
| InChIKey | JBNULORNFPEKSI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|