C16H18ClN5O3 — CID 87452495
1-methoxyethyl 4-[1-(2-chloro-3-pyridinyl)triazol-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 87452495) has the molecular formula C16H18ClN5O3 and a molecular weight of 363.81 g/mol. Its IUPAC name is 1-methoxyethyl 4-[1-(2-chloro-3-pyridinyl)triazol-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | 1-methoxyethyl 4-[1-(2-chloro-3-pyridinyl)triazol-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 87452495 |
| Molecular Formula | C16H18ClN5O3 |
| Molecular Weight | 363.81 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 1-methoxyethyl 4-[1-(2-chloro-3-pyridinyl)triazol-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COC(C)OC(=O)N1CC=C(c2cn(-c3cccnc3Cl)nn2)CC1 |
| InChI | InChI=1S/C16H18ClN5O3/c1-11(24-2)25-16(23)21-8-5-12(6-9-21)13-10-22(20-19-13)14-4-3-7-18-15(14)17/h3-5,7,10-11H,6,8-9H2,1-2H3 |
| InChIKey | WZXSKXXEOBELOR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.81 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|