C15H12ClN5 — CID 167944483
6-[1-(2-chloro-3-pyridinyl)triazol-4-yl]-2,3-dihydro-1H-indole (PubChem CID 167944483) has the molecular formula C15H12ClN5 and a molecular weight of 297.75 g/mol. Its IUPAC name is 6-[1-(2-chloro-3-pyridinyl)triazol-4-yl]-2,3-dihydro-1H-indole.
| Compound Name | 6-[1-(2-chloro-3-pyridinyl)triazol-4-yl]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 167944483 |
| Molecular Formula | C15H12ClN5 |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 6-[1-(2-chloro-3-pyridinyl)triazol-4-yl]-2,3-dihydro-1H-indole |
| SMILES | Clc1ncccc1-n1cc(-c2ccc3c(c2)NCC3)nn1 |
| InChI | InChI=1S/C15H12ClN5/c16-15-14(2-1-6-18-15)21-9-13(19-20-21)11-4-3-10-5-7-17-12(10)8-11/h1-4,6,8-9,17H,5,7H2 |
| InChIKey | SFDVCBMOFFVRSI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|