C14H19N5O2 — CID 144802146
ethyl 4-[2-(diaminomethylideneamino)-3-pyridinyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 144802146) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is ethyl 4-[2-(diaminomethylideneamino)-3-pyridinyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | ethyl 4-[2-(diaminomethylideneamino)-3-pyridinyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 144802146 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | ethyl 4-[2-(diaminomethylideneamino)-3-pyridinyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CCOC(=O)N1CC=C(c2cccnc2N=C(N)N)CC1 |
| InChI | InChI=1S/C14H19N5O2/c1-2-21-14(20)19-8-5-10(6-9-19)11-4-3-7-17-12(11)18-13(15)16/h3-5,7H,2,6,8-9H2,1H3,(H4,15,16,17,18) |
| InChIKey | UVBHDSIWFLKWOU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|