About ethyl 4-pyrrolidin-1-yl-3,6-dihydro-2H-pyridine-1-carboxylate
ethyl 4-pyrrolidin-1-yl-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 12582758) has the molecular formula C12H20N2O2
and a molecular weight of 224.30 g/mol. Its IUPAC name is ethyl 4-pyrrolidin-1-yl-3,6-dihydro-2H-pyridine-1-carboxylate.
Analyze ethyl 4-pyrrolidin-1-yl-3,6-dihydro-2H-pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-pyrrolidin-1-yl-3,6-dihydro-2H-pyridine-1-carboxylate?
The IUPAC name of ethyl 4-pyrrolidin-1-yl-3,6-dihydro-2H-pyridine-1-carboxylate (CID 12582758) is ethyl 4-pyrrolidin-1-yl-3,6-dihydro-2H-pyridine-1-carboxylate.
What is the SMILES notation for ethyl 4-pyrrolidin-1-yl-3,6-dihydro-2H-pyridine-1-carboxylate?
The canonical SMILES for ethyl 4-pyrrolidin-1-yl-3,6-dihydro-2H-pyridine-1-carboxylate is CCOC(=O)N1CC=C(N2CCCC2)CC1.
What is the InChIKey of ethyl 4-pyrrolidin-1-yl-3,6-dihydro-2H-pyridine-1-carboxylate?
The InChIKey is BOBUJEPCIKNLDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2/c1-2-16-12(15)14-9-5-11(6-10-14)13-7-3-4-8-13/h5H,2-4,6-10H2,1H3.
What are the key properties of ethyl 4-pyrrolidin-1-yl-3,6-dihydro-2H-pyridine-1-carboxylate?
ethyl 4-pyrrolidin-1-yl-3,6-dihydro-2H-pyridine-1-carboxylate has a molecular weight of 224.30 g/mol, XLogP of 1.83, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-pyrrolidin-1-yl-3,6-dihydro-2H-pyridine-1-carboxylate is sourced from PubChem (CID 12582758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).