C13H19NS — CID 143164245
(3Z)-3-methylhexa-1,3,5-triene;N-[(1E)-1-methylsulfanylbuta-1,3-dienyl]methanimine (PubChem CID 143164245) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is (3Z)-3-methylhexa-1,3,5-triene;N-[(1E)-1-methylsulfanylbuta-1,3-dienyl]methanimine.
| Compound Name | (3Z)-3-methylhexa-1,3,5-triene;N-[(1E)-1-methylsulfanylbuta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 143164245 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (3Z)-3-methylhexa-1,3,5-triene;N-[(1E)-1-methylsulfanylbuta-1,3-dienyl]methanimine |
| SMILES | C=C/C=C(/C)C=C.C=C/C=C(\N=C)SC |
| InChI | InChI=1S/C7H10.C6H9NS/c1-4-6-7(3)5-2;1-4-5-6(7-2)8-3/h4-6H,1-2H2,3H3;4-5H,1-2H2,3H3/b7-6-;6-5+ |
| InChIKey | GSUIINMOTGYRGZ-WDQQFLGVSA-N |
| XLogP | 4.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|