C7H11NS — CID 142557503
N-[(1E,3Z)-1-methylsulfanylpenta-1,3-dienyl]methanimine (PubChem CID 142557503) has the molecular formula C7H11NS and a molecular weight of 141.24 g/mol. Its IUPAC name is N-[(1E,3Z)-1-methylsulfanylpenta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3Z)-1-methylsulfanylpenta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 142557503 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | N-[(1E,3Z)-1-methylsulfanylpenta-1,3-dienyl]methanimine |
| SMILES | C=N/C(=C\C=C/C)SC |
| InChI | InChI=1S/C7H11NS/c1-4-5-6-7(8-2)9-3/h4-6H,2H2,1,3H3/b5-4-,7-6+ |
| InChIKey | DMNGGMDYWIQLMO-SCFJQAPRSA-N |
| XLogP | 2.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|