About 1-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)ethanol
1-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)ethanol (PubChem CID 143164926) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 1-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)ethanol.
Analyze 1-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)ethanol?
The IUPAC name of 1-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)ethanol (CID 143164926) is 1-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)ethanol.
What is the SMILES notation for 1-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)ethanol?
The canonical SMILES for 1-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)ethanol is CC(O)C1=CNC2NC=CC2=C1.
What is the InChIKey of 1-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)ethanol?
The InChIKey is ZEKXUEZZJLZSHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-6(12)8-4-7-2-3-10-9(7)11-5-8/h2-6,9-12H,1H3.
What are the key properties of 1-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)ethanol?
1-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)ethanol has a molecular weight of 164.21 g/mol, XLogP of 0.22, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)ethanol is sourced from PubChem (CID 143164926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).