C8H14N2O — CID 86341148
[2-(dimethylamino)-1,2-dihydropyridin-5-yl]methanol (PubChem CID 86341148) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is [2-(dimethylamino)-1,2-dihydropyridin-5-yl]methanol.
| Compound Name | [2-(dimethylamino)-1,2-dihydropyridin-5-yl]methanol |
|---|---|
| PubChem CID | 86341148 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | [2-(dimethylamino)-1,2-dihydropyridin-5-yl]methanol |
| SMILES | CN(C)C1C=CC(CO)=CN1 |
| InChI | InChI=1S/C8H14N2O/c1-10(2)8-4-3-7(6-11)5-9-8/h3-5,8-9,11H,6H2,1-2H3 |
| InChIKey | DVQAEBFTXPCQAV-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |