About [2-(propan-2-ylamino)-1,2-dihydropyridin-5-yl]methanol
[2-(propan-2-ylamino)-1,2-dihydropyridin-5-yl]methanol (PubChem CID 86341532) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is [2-(propan-2-ylamino)-1,2-dihydropyridin-5-yl]methanol.
Molecular Properties
| Compound Name | [2-(propan-2-ylamino)-1,2-dihydropyridin-5-yl]methanol |
| PubChem CID | 86341532 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | [2-(propan-2-ylamino)-1,2-dihydropyridin-5-yl]methanol |
| SMILES | CC(C)NC1C=CC(CO)=CN1 |
| InChI | InChI=1S/C9H16N2O/c1-7(2)11-9-4-3-8(6-12)5-10-9/h3-5,7,9-12H,6H2,1-2H3 |
| InChIKey | LNQQSRJYPCUPTL-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(propan-2-ylamino)-1,2-dihydropyridin-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(propan-2-ylamino)-1,2-dihydropyridin-5-yl]methanol?
The IUPAC name of [2-(propan-2-ylamino)-1,2-dihydropyridin-5-yl]methanol (CID 86341532) is [2-(propan-2-ylamino)-1,2-dihydropyridin-5-yl]methanol.
What is the SMILES notation for [2-(propan-2-ylamino)-1,2-dihydropyridin-5-yl]methanol?
The canonical SMILES for [2-(propan-2-ylamino)-1,2-dihydropyridin-5-yl]methanol is CC(C)NC1C=CC(CO)=CN1.
What is the InChIKey of [2-(propan-2-ylamino)-1,2-dihydropyridin-5-yl]methanol?
The InChIKey is LNQQSRJYPCUPTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c1-7(2)11-9-4-3-8(6-12)5-10-9/h3-5,7,9-12H,6H2,1-2H3.
What are the key properties of [2-(propan-2-ylamino)-1,2-dihydropyridin-5-yl]methanol?
[2-(propan-2-ylamino)-1,2-dihydropyridin-5-yl]methanol has a molecular weight of 168.24 g/mol, XLogP of 0.35, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(propan-2-ylamino)-1,2-dihydropyridin-5-yl]methanol is sourced from PubChem (CID 86341532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).