C8H15NO — CID 91537048
ethane;5-methyl-1,2-dihydropyridin-2-ol (PubChem CID 91537048) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is ethane;5-methyl-1,2-dihydropyridin-2-ol.
| Compound Name | ethane;5-methyl-1,2-dihydropyridin-2-ol |
|---|---|
| PubChem CID | 91537048 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | ethane;5-methyl-1,2-dihydropyridin-2-ol |
| SMILES | CC.CC1=CNC(O)C=C1 |
| InChI | InChI=1S/C6H9NO.C2H6/c1-5-2-3-6(8)7-4-5;1-2/h2-4,6-8H,1H3;1-2H3 |
| InChIKey | XGDXWGUTDBXDCN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |