C6H8FNO — CID 118083858
3-fluoro-5-methyl-1,2-dihydropyridin-2-ol (PubChem CID 118083858) has the molecular formula C6H8FNO and a molecular weight of 129.13 g/mol. Its IUPAC name is 3-fluoro-5-methyl-1,2-dihydropyridin-2-ol.
| Compound Name | 3-fluoro-5-methyl-1,2-dihydropyridin-2-ol |
|---|---|
| PubChem CID | 118083858 |
| Molecular Formula | C6H8FNO |
| Molecular Weight | 129.13 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | 3-fluoro-5-methyl-1,2-dihydropyridin-2-ol |
| SMILES | CC1=CNC(O)C(F)=C1 |
| InChI | InChI=1S/C6H8FNO/c1-4-2-5(7)6(9)8-3-4/h2-3,6,8-9H,1H3 |
| InChIKey | AOTWFJGXJGCDSI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.13 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |